ChemNet > CAS > 19353-92-5 4-Dimethylaminobenzhydrazide
19353-92-5 4-Dimethylaminobenzhydrazide
Nazwa produktu: |
4-Dimethylaminobenzhydrazide |
Angielska nazwa |
4-Dimethylaminobenzhydrazide; 4-(Dimethylamino)-benzoylhydrazine; LABOTEST-BB LT00454413; 4-DIMETHYLAMINO-BENZOIC ACID HYDRAZIDE; 4-(DIMETHYLAMINO)BENZENE-1-CARBOHYDRAZIDE; 4-(N,N-DIMETHYLAMINO)BENZHYDRAZIDE; AKOS BC-1518; 4-Dimethylaminobenzohydrazide; Benzoic acid, 4-(dimethylamino)-, hydrazide; 3-(dimethylamino)benzohydrazide |
MF |
C9H13N3O |
Masie cząsteczkowej |
179.219 |
InChI |
InChI=1/C9H13N3O/c1-12(2)8-5-3-4-7(6-8)9(13)11-10/h3-6H,10H2,1-2H3,(H,11,13) |
Nr CAS |
19353-92-5 |
EINECS |
242-985-1 |
Struktury molekularnej |
|
Gęstość |
1.156g/cm3 |
Temperatura topnienia |
172-173℃ |
Współczynnik załamania |
1.601 |
Symbole zagrożenia |
Xi:;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|