ChemNet > CAS > 1947-47-3 3-Amino-2-phenylindenone
1947-47-3 3-Amino-2-phenylindenone
| Nazwa produktu: |
3-Amino-2-phenylindenone |
| Angielska nazwa |
3-Amino-2-phenylindenone; 3-Amino-2-phenyl-1H-inden-1-one; (2R,3Z)-3-imino-2-phenyl-2,3-dihydro-1H-inden-1-one |
| MF |
C15H11NO |
| Masie cząsteczkowej |
221.2539 |
| InChI |
InChI=1/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9,13,16H/b16-14+/t13-/m1/s1 |
| Nr CAS |
1947-47-3 |
| Struktury molekularnej |
|
| Gęstość |
1.21g/cm3 |
| Temperatura topnienia |
270℃ |
| Temperatura wrzenia |
415.6°C at 760 mmHg |
| Współczynnik załamania |
1.652 |
| Temperatura zapłonu |
205.1°C |
| Ciśnienie pary |
4.09E-07mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
