ChemNet > CAS > 202865-85-8 2-Bromo-5-iodotoluene
202865-85-8 2-Bromo-5-iodotoluene
| Nazwa produktu: |
2-Bromo-5-iodotoluene |
| Angielska nazwa |
2-Bromo-5-iodotoluene;1-bromo-4-iodo-2-methylbenzene |
| MF |
C7H6BrI |
| Masie cząsteczkowej |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Nr CAS |
202865-85-8 |
| Struktury molekularnej |
|
| Gęstość |
2.062g/cm3 |
| Temperatura wrzenia |
264.2°C at 760 mmHg |
| Współczynnik załamania |
1.636 |
| Temperatura zapłonu |
113.6°C |
| Ciśnienie pary |
0.0161mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
