ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
| Nazwa produktu: |
3-Chloro-4-fluoroanisole |
| Angielska nazwa |
3-Chloro-4-fluoroanisole;2-chloro-1-fluoro-4-methoxybenzene |
| MF |
C7H6ClFO |
| Masie cząsteczkowej |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| Nr CAS |
202925-07-3 |
| Struktury molekularnej |
|
| Gęstość |
1.239g/cm3 |
| Temperatura wrzenia |
202.8°C at 760 mmHg |
| Współczynnik załamania |
1.495 |
| Temperatura zapłonu |
76.4°C |
| Ciśnienie pary |
0.409mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
