ChemNet > CAS > 2051-49-2 Hexanoic anhydride
2051-49-2 Hexanoic anhydride
| Nazwa produktu: |
Hexanoic anhydride |
| Angielska nazwa |
Hexanoic anhydride; Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
| MF |
C12H22O3 |
| Masie cząsteczkowej |
214.3013 |
| InChI |
InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
| Nr CAS |
2051-49-2 |
| EINECS |
218-121-4 |
| Struktury molekularnej |
|
| Gęstość |
0.943g/cm3 |
| Temperatura topnienia |
-40℃ |
| Temperatura wrzenia |
247°C at 760 mmHg |
| Współczynnik załamania |
1.436 |
| Temperatura zapłonu |
116.6°C |
| Ciśnienie pary |
0.0263mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
