2051-49-2 Hexanoic anhydride
Nazwa produktu: |
Hexanoic anhydride |
Angielska nazwa |
Hexanoic anhydride; Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
MF |
C12H22O3 |
Masie cząsteczkowej |
214.3013 |
InChI |
InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
Nr CAS |
2051-49-2 |
EINECS |
218-121-4 |
Struktury molekularnej |
|
Gęstość |
0.943g/cm3 |
Temperatura topnienia |
-40℃ |
Temperatura wrzenia |
247°C at 760 mmHg |
Współczynnik załamania |
1.436 |
Temperatura zapłonu |
116.6°C |
Ciśnienie pary |
0.0263mmHg at 25°C |
Symbole zagrożenia |
C:Corrosive;
|
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|