ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
| Nazwa produktu: |
3-(trifluoromethyl)phenoxyacetonitrile |
| Angielska nazwa |
3-(trifluoromethyl)phenoxyacetonitrile; 2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
| MF |
C8H7FO3 |
| Masie cząsteczkowej |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
| Nr CAS |
2145-31-5 |
| Struktury molekularnej |
|
| Gęstość |
1.309g/cm3 |
| Temperatura wrzenia |
268.9°C at 760 mmHg |
| Współczynnik załamania |
1.526 |
| Temperatura zapłonu |
116.4°C |
| Ciśnienie pary |
0.00452mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
