ChemNet > CAS > 2156-04-9 4-Vinylbenzeneboronic acid
2156-04-9 4-Vinylbenzeneboronic acid
Nazwa produktu: |
4-Vinylbenzeneboronic acid |
Angielska nazwa |
4-Vinylbenzeneboronic acid; 4-Vinylphenylboronic acid; Styrene-4-boronic acid; (4-ethenylphenyl)boronic acid |
MF |
C8H9BO2 |
Masie cząsteczkowej |
147.9669 |
InChI |
InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
Nr CAS |
2156-04-9 |
Struktury molekularnej |
|
Gęstość |
1.09g/cm3 |
Temperatura topnienia |
188-189℃ |
Temperatura wrzenia |
306.2°C at 760 mmHg |
Współczynnik załamania |
1.539 |
Temperatura zapłonu |
139°C |
Ciśnienie pary |
0.000341mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|