ChemNet > CAS > 21581-45-3 3,4-Dichlorophenethylamine
21581-45-3 3,4-Dichlorophenethylamine
| Nazwa produktu: |
3,4-Dichlorophenethylamine |
| Angielska nazwa |
3,4-Dichlorophenethylamine;2-(3,4-dichlorophenyl)ethanamine; 2-(3,4-dichlorophenyl)ethanaminium; 3,4-Dichloro-benzeneethanamine |
| MF |
C8H10Cl2N |
| Masie cząsteczkowej |
191.0772 |
| InChI |
InChI=1/C8H9Cl2N/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5H,3-4,11H2/p+1 |
| Nr CAS |
21581-45-3 |
| Struktury molekularnej |
|
| Temperatura wrzenia |
268.8°C at 760 mmHg |
| Temperatura zapłonu |
116.4°C |
| Ciśnienie pary |
0.00753mmHg at 25°C |
| Symbole zagrożenia |
C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|