ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
| Nazwa produktu: |
3-Cyclohexene-1,1-dimethanol |
| Angielska nazwa |
3-Cyclohexene-1,1-dimethanol; 4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
| MF |
C8H14O2 |
| Masie cząsteczkowej |
142.1956 |
| InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
| Nr CAS |
2160-94-3 |
| EINECS |
218-481-2 |
| Struktury molekularnej |
|
| Gęstość |
1.05g/cm3 |
| Temperatura topnienia |
88-92℃ |
| Temperatura wrzenia |
231.2°C at 760 mmHg |
| Współczynnik załamania |
1.497 |
| Temperatura zapłonu |
105°C |
| Ciśnienie pary |
0.0119mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|
