ChemNet > CAS > 216393-55-4 Methyl 3,5-difluorobenzoate
216393-55-4 Methyl 3,5-difluorobenzoate
Nazwa produktu: |
Methyl 3,5-difluorobenzoate |
Angielska nazwa |
Methyl 3,5-difluorobenzoate; 3,5-Difluorobenzoic acid methyl ester |
MF |
C8H6F2O2 |
Masie cząsteczkowej |
172.1288 |
InChI |
InChI=1/C8H6F2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
Nr CAS |
216393-55-4 |
Struktury molekularnej |
|
Gęstość |
1.268g/cm3 |
Temperatura wrzenia |
202.7°C at 760 mmHg |
Współczynnik załamania |
1.472 |
Temperatura zapłonu |
74.6°C |
Ciśnienie pary |
0.288mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|