ChemNet > CAS > 21667-62-9 3-Chlorobenzoylacetonitrile,
21667-62-9 3-Chlorobenzoylacetonitrile,
| Nazwa produktu: |
3-Chlorobenzoylacetonitrile, |
| Angielska nazwa |
3-Chlorobenzoylacetonitrile,; 3-Chlorobenzoylacetonitrile; 3-(3-Chlorophenyl)-3-oxopropanenitrile |
| MF |
C9H6ClNO |
| Masie cząsteczkowej |
179.603 |
| InChI |
InChI=1/C9H6ClNO/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6H,4H2 |
| Nr CAS |
21667-62-9 |
| Struktury molekularnej |
|
| Gęstość |
1.257g/cm3 |
| Temperatura topnienia |
78℃ |
| Temperatura wrzenia |
347.1°C at 760 mmHg |
| Współczynnik załamania |
1.553 |
| Temperatura zapłonu |
163.7°C |
| Ciśnienie pary |
5.49E-05mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
