ChemNet > CAS > 2184-88-5 4-chloro-alfa-metylofenyloacetonitryl
2184-88-5 4-chloro-alfa-metylofenyloacetonitryl
| Nazwa produktu: |
4-chloro-alfa-metylofenyloacetonitryl |
| Synonimy |
2-(p-chlorofenylo)propionitryl; 2-(4-chlorofenylo)propanenitryl |
| Angielska nazwa |
4-Chloro-alpha-methylphenylacetonitrile; 2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| MF |
C9H8ClN |
| Masie cząsteczkowej |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| Nr CAS |
2184-88-5 |
| EINECS |
218-569-0 |
| Struktury molekularnej |
|
| Gęstość |
1.143g/cm3 |
| Temperatura wrzenia |
260.3°C at 760 mmHg |
| Współczynnik załamania |
1.537 |
| Temperatura zapłonu |
104°C |
| Ciśnienie pary |
0.0123mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|