ChemNet > CAS > 2184-88-5 4-chloro-alfa-metylofenyloacetonitryl
2184-88-5 4-chloro-alfa-metylofenyloacetonitryl
Nazwa produktu: |
4-chloro-alfa-metylofenyloacetonitryl |
Synonimy |
2-(p-chlorofenylo)propionitryl; 2-(4-chlorofenylo)propanenitryl |
Angielska nazwa |
4-Chloro-alpha-methylphenylacetonitrile; 2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
MF |
C9H8ClN |
Masie cząsteczkowej |
165.6195 |
InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
Nr CAS |
2184-88-5 |
EINECS |
218-569-0 |
Struktury molekularnej |
|
Gęstość |
1.143g/cm3 |
Temperatura wrzenia |
260.3°C at 760 mmHg |
Współczynnik załamania |
1.537 |
Temperatura zapłonu |
104°C |
Ciśnienie pary |
0.0123mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|