2210-28-8 n-Propyl methacrylate
Nazwa produktu: |
n-Propyl methacrylate |
Angielska nazwa |
n-Propyl methacrylate; n-Propyl methacrylate, (Methacrylic acid n-propyl ester); Methacrylic acid n-propyl ester; propyl 2-methylprop-2-enoate |
MF |
C7H12O2 |
Masie cząsteczkowej |
128.169 |
InChI |
InChI=1/C7H12O2/c1-4-5-9-7(8)6(2)3/h2,4-5H2,1,3H3 |
Nr CAS |
2210-28-8 |
EINECS |
218-639-0 |
Struktury molekularnej |
|
Gęstość |
0.899g/cm3 |
Temperatura wrzenia |
141°C at 760 mmHg |
Współczynnik załamania |
1.416 |
Temperatura zapłonu |
34.7°C |
Ciśnienie pary |
5.98mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|