ChemNet > CAS > 22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
| Nazwa produktu: |
benzoic acid, compound with dicyclohexylamine (1:1) |
| Angielska nazwa |
benzoic acid, compound with dicyclohexylamine (1:1);Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1); Benzoic acid dicyclohexylamine salt; Dicyclohexylamine benzoate; Dicyclohexylammonium benzoate; Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI); Benzoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine, compd. with benzoic acid (7CI); N-cyclohexylcyclohexanamine benzoate (1:1) |
| MF |
C19H29NO2 |
| Masie cząsteczkowej |
303.4391 |
| InChI |
InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| Nr CAS |
22355-34-6 |
| EINECS |
244-932-8 |
| Struktury molekularnej |
|
| Temperatura wrzenia |
256.1°C at 760 mmHg |
| Temperatura zapłonu |
96.1°C |
| Ciśnienie pary |
0.0157mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
|
|
