2243-42-7 2-Phenoxybenzoic acid
Nazwa produktu: |
2-Phenoxybenzoic acid |
Angielska nazwa |
2-Phenoxybenzoic acid; 2-Carboxydiphenyl ether; 2-phenoxybenzoate |
MF |
C13H9O3 |
Masie cząsteczkowej |
213.2093 |
InChI |
InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
Nr CAS |
2243-42-7 |
EINECS |
218-811-5 |
Struktury molekularnej |
|
Temperatura topnienia |
111-115℃ |
Temperatura wrzenia |
343.3°C at 760 mmHg |
Temperatura zapłonu |
132°C |
Ciśnienie pary |
2.73E-05mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|