ChemNet > CAS > 22590-64-3 3-(oksyran-2-ylmetoksy)benzaldehyd
22590-64-3 3-(oksyran-2-ylmetoksy)benzaldehyd
| Nazwa produktu: |
3-(oksyran-2-ylmetoksy)benzaldehyd |
| Angielska nazwa |
3-(oxiran-2-ylmethoxy)benzaldehyde; |
| MF |
C10H10O3 |
| Masie cząsteczkowej |
178.1846 |
| InChI |
InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| Nr CAS |
22590-64-3 |
| Struktury molekularnej |
|
| Gęstość |
1.225g/cm3 |
| Temperatura wrzenia |
318.2°C at 760 mmHg |
| Współczynnik załamania |
1.581 |
| Temperatura zapłonu |
137.2°C |
| Ciśnienie pary |
0.000367mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
