ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
| Nazwa produktu: |
5-Bromo-2-methyl-2-pentene |
| Angielska nazwa |
5-Bromo-2-methyl-2-pentene; 5-bromo-2-methylpent-2-ene |
| MF |
C6H11Br |
| Masie cząsteczkowej |
163.0555 |
| InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
| Nr CAS |
2270-59-9 |
| Struktury molekularnej |
|
| Gęstość |
1.215g/cm3 |
| Temperatura wrzenia |
152.6°C at 760 mmHg |
| Współczynnik załamania |
1.47 |
| Temperatura zapłonu |
22.8°C |
| Ciśnienie pary |
4.44mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
