ChemNet > CAS > 22884-95-3 3,4-Dimethylbenzonitrile
22884-95-3 3,4-Dimethylbenzonitrile
Nazwa produktu: |
3,4-Dimethylbenzonitrile |
Angielska nazwa |
3,4-Dimethylbenzonitrile;Benzonitrile, 3,4-dimethyl-; 0-09-00-00536 (Beilstein Handbook Reference); BRN 0970523 |
MF |
C9H9N |
Masie cząsteczkowej |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-3-4-9(6-10)5-8(7)2/h3-5H,1-2H3 |
Nr CAS |
22884-95-3 |
EINECS |
245-293-8 |
Struktury molekularnej |
|
Gęstość |
0.99g/cm3 |
Temperatura topnienia |
64-66℃ |
Temperatura wrzenia |
253.5°C at 760 mmHg |
Współczynnik załamania |
1.525 |
Temperatura zapłonu |
107.1°C |
Ciśnienie pary |
0.0182mmHg at 25°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|