ChemNet > CAS > 23806-24-8 3-Methylthiophene-2-carboxylic acid
23806-24-8 3-Methylthiophene-2-carboxylic acid
Nazwa produktu: |
3-Methylthiophene-2-carboxylic acid |
Angielska nazwa |
3-Methylthiophene-2-carboxylic acid; 3-Methyl-2-thiophenecarboxylic acid; 3-methylthiophene-2-carboxylate; RARECHEM AL BO 0517; 3-Methylthiophene-2-carboxylic |
MF |
C6H5O2S |
Masie cząsteczkowej |
141.1682 |
InChI |
InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)/p-1 |
Nr CAS |
23806-24-8 |
EINECS |
245-894-5 |
Struktury molekularnej |
|
Temperatura topnienia |
145-146℃ |
Temperatura wrzenia |
274°C at 760 mmHg |
Temperatura zapłonu |
119.5°C |
Ciśnienie pary |
0.0027mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S24/25:;
|
|