ChemNet > CAS > 2471-70-7 6-methoxy-2-naphthoic acid
2471-70-7 6-methoxy-2-naphthoic acid
Nazwa produktu: |
6-methoxy-2-naphthoic acid |
Angielska nazwa |
6-methoxy-2-naphthoic acid; 6-Methoxy-naphthalene-2-carboxylic acid; 6-methoxynaphthalene-2-carboxylate |
MF |
C12H9O3 |
Masie cząsteczkowej |
201.1986 |
InChI |
InChI=1/C12H10O3/c1-15-11-5-4-8-6-10(12(13)14)3-2-9(8)7-11/h2-7H,1H3,(H,13,14)/p-1 |
Nr CAS |
2471-70-7 |
Struktury molekularnej |
|
Temperatura wrzenia |
371.1°C at 760 mmHg |
Temperatura zapłonu |
147.8°C |
Ciśnienie pary |
3.65E-06mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|