ChemNet > CAS > 25038-71-5 poli(etylen-ko-tetrafluoroetylen)
25038-71-5 poli(etylen-ko-tetrafluoroetylen)
| Nazwa produktu: |
poli(etylen-ko-tetrafluoroetylen) |
| Synonimy |
Tefzel; Eten, 1,1,2,2-tetrafluoro-, polimer z etenem; Eten, tetrafluoro-, polimer z etenem; eten - tetrafluoroeten (1:1) |
| Angielska nazwa |
poly(ethylene-co-tetrafluoroethylene);Tefzel; Ethene, 1,1,2,2-tetrafluoro-, polymer with ethene; Ethene, tetrafluoro-, polymer with ethene; ethene - tetrafluoroethene (1:1) |
| MF |
C4H4F4 |
| Masie cząsteczkowej |
128.0682 |
| InChI |
InChI=1/C2F4.C2H4/c3-1(4)2(5)6;1-2/h;1-2H2 |
| Nr CAS |
25038-71-5 |
| Struktury molekularnej |
|
| Ciśnienie pary |
20000mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
|
|
