25117-74-2 4-Ethoxybenzonitrile
Nazwa produktu: |
4-Ethoxybenzonitrile |
Angielska nazwa |
4-Ethoxybenzonitrile; 4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
MF |
C9H9NO |
Masie cząsteczkowej |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
Nr CAS |
25117-74-2 |
Struktury molekularnej |
|
Gęstość |
1.05g/cm3 |
Temperatura wrzenia |
258°C at 760 mmHg |
Współczynnik załamania |
1.52 |
Temperatura zapłonu |
110.9°C |
Ciśnienie pary |
0.0141mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|