ChemNet > CAS > 25153-40-6 Methyl vinyl ether/maleic acid copolymer
25153-40-6 Methyl vinyl ether/maleic acid copolymer
Nazwa produktu: |
Methyl vinyl ether/maleic acid copolymer |
Angielska nazwa |
Methyl vinyl ether/maleic acid copolymer; Poly(methyl vinyl ether-alt-maleic acid); methoxyethene-(2Z)-but-2-enedioic acid (1:1); poly(methyl vinyl ether/maleic acid)copolymer; Poly( methyl vinyl ether/maleic acid)copolymer (PP series) |
MF |
C7H10O5 |
Masie cząsteczkowej |
174.1513 |
InChI |
InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
Nr CAS |
25153-40-6 |
Struktury molekularnej |
|
Temperatura wrzenia |
355.5°C at 760 mmHg |
Temperatura zapłonu |
183°C |
Ciśnienie pary |
5.19E-06mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|