ChemNet > CAS > 2555-05-7 3-Methyl-2-pyrrolidinone
2555-05-7 3-Methyl-2-pyrrolidinone
Nazwa produktu: |
3-Methyl-2-pyrrolidinone |
Angielska nazwa |
3-Methyl-2-pyrrolidinone; alpha-Methylbutyrolactam~3-Methyl-2-pyrrolidone; 3-methylpyrrolidin-2-one |
MF |
C5H9NO |
Masie cząsteczkowej |
99.1311 |
InChI |
InChI=1/C5H9NO/c1-4-2-3-6-5(4)7/h4H,2-3H2,1H3,(H,6,7) |
Nr CAS |
2555-05-7 |
EINECS |
219-865-2 |
Struktury molekularnej |
|
Gęstość |
0.979g/cm3 |
Temperatura wrzenia |
240.5°C at 760 mmHg |
Współczynnik załamania |
1.439 |
Temperatura zapłonu |
127.5°C |
Ciśnienie pary |
0.0377mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|