ChemNet > CAS > 2586-62-1 1-Bromo-2-methylnaphthalene
2586-62-1 1-Bromo-2-methylnaphthalene
Nazwa produktu: |
1-Bromo-2-methylnaphthalene |
Angielska nazwa |
1-Bromo-2-methylnaphthalene; 1-Bromo-2-methylnaphtalene |
MF |
C11H9Br |
Masie cząsteczkowej |
221.0932 |
InChI |
InChI=1/C11H9Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
Nr CAS |
2586-62-1 |
EINECS |
219-966-1 |
Struktury molekularnej |
|
Gęstość |
1.417g/cm3 |
Temperatura wrzenia |
300.9°C at 760 mmHg |
Współczynnik załamania |
1.645 |
Temperatura zapłonu |
137.4°C |
Ciśnienie pary |
0.00195mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|