25928-81-8 polybenzimidazole
Nazwa produktu: |
polybenzimidazole |
Angielska nazwa |
polybenzimidazole;1,3-Benzenedicarboxylic acid, 1,3-diphenyl ester, polymer with (1,1'-biphenyl)-3,3',4,4'-tetramine; Diphenyl isophthalate, 3,3',4,4'-tetraaminobiphenyl polymer; 1,3-Benzenedicarboxylic acid, diphenyl ester, polymer with (1,1'-biphenyl)-3,3',4,4'-tetramine; 1H-benzimidazole |
MF |
C7H6N2 |
Masie cząsteczkowej |
118.1359 |
InChI |
InChI=1/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9) |
Nr CAS |
25928-81-8 |
EINECS |
200-081-4 |
Gęstość |
1.242g/cm3 |
Temperatura wrzenia |
360°C at 760 mmHg |
Współczynnik załamania |
1.696 |
Temperatura zapłonu |
208.4°C |
Ciśnienie pary |
4.74E-05mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
|
|