ChemNet > CAS > 2648-61-5 2,2-Dichloroacetophenone
2648-61-5 2,2-Dichloroacetophenone
Nazwa produktu: |
2,2-Dichloroacetophenone |
Angielska nazwa |
2,2-Dichloroacetophenone; 2,2-Dichloro-1-phenylethanone; alpha,alpha-Dichloroacetophenone; Phenacylidene chloride |
MF |
C8H6Cl2O |
Masie cząsteczkowej |
189.0386 |
InChI |
InChI=1/C8H6Cl2O/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,8H |
Nr CAS |
2648-61-5 |
Struktury molekularnej |
|
Gęstość |
1.311g/cm3 |
Temperatura topnienia |
21℃ |
Temperatura wrzenia |
252.3°C at 760 mmHg |
Współczynnik załamania |
1.55 |
Temperatura zapłonu |
103.6°C |
Ciśnienie pary |
0.0194mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|