ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
Nazwa produktu: |
Benzylidenemalononitrile |
Angielska nazwa |
Benzylidenemalononitrile; beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
MF |
C10H6N2 |
Masie cząsteczkowej |
154.168 |
InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
Nr CAS |
2700-22-3 |
EINECS |
220-283-6 |
Struktury molekularnej |
|
Gęstość |
1.154g/cm3 |
Temperatura topnienia |
82-86℃ |
Temperatura wrzenia |
294.8°C at 760 mmHg |
Współczynnik załamania |
1.612 |
Temperatura zapłonu |
138°C |
Ciśnienie pary |
0.00159mmHg at 25°C |
Symbole zagrożenia |
T:Toxic;
|
Kody ryzyka |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|