ChemNet > CAS > 2873-74-7 Glutaryl dichloride
2873-74-7 Glutaryl dichloride
| Nazwa produktu: |
Glutaryl dichloride |
| Angielska nazwa |
Glutaryl dichloride; Glutaryl chloride; Pentanedioyl dichloride~1,3-Propanedicarbonyl chloride; pentanedioyl dichloride |
| MF |
C5H6Cl2O2 |
| Masie cząsteczkowej |
169.0059 |
| InChI |
InChI=1/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
| Nr CAS |
2873-74-7 |
| EINECS |
220-711-1 |
| Struktury molekularnej |
|
| Gęstość |
1.319g/cm3 |
| Temperatura wrzenia |
217.8°C at 760 mmHg |
| Współczynnik załamania |
1.458 |
| Temperatura zapłonu |
106.7°C |
| Ciśnienie pary |
0.13mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
