ChemNet > CAS > 2879-42-7 3-Chloro-2,5,6-trifluoropyridine
2879-42-7 3-Chloro-2,5,6-trifluoropyridine
| Nazwa produktu: |
3-Chloro-2,5,6-trifluoropyridine |
| Angielska nazwa |
3-Chloro-2,5,6-trifluoropyridine; |
| MF |
C5HClF3N |
| Masie cząsteczkowej |
167.5163 |
| InChI |
InChI=1/C5HClF3N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| Nr CAS |
2879-42-7 |
| Struktury molekularnej |
|
| Gęstość |
1.562g/cm3 |
| Temperatura wrzenia |
151.7°C at 760 mmHg |
| Współczynnik załamania |
1.457 |
| Temperatura zapłonu |
45.6°C |
| Ciśnienie pary |
4.62mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
