ChemNet > CAS > 2912-62-1 chlorek DL-2-chloro-2-fenyloacetylu
2912-62-1 chlorek DL-2-chloro-2-fenyloacetylu
| Nazwa produktu: |
chlorek DL-2-chloro-2-fenyloacetylu |
| Synonimy |
chlorek chloro(fenylo)acetylu; CCRIS 8624; chlorek (2S)-chloro(fenylo)etanoilu; chlorek (2R)-chloro(fenylo)etanoilu |
| Angielska nazwa |
DL-2-Chloro-2-phenylacetyl chloride;Chloro(phenyl)acetyl chloride; CCRIS 8624; (2S)-chloro(phenyl)ethanoyl chloride; (2R)-chloro(phenyl)ethanoyl chloride |
| MF |
C8H6Cl2O |
| Masie cząsteczkowej |
189.0386 |
| InChI |
InChI=1/C8H6Cl2O/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H/t7-/m1/s1 |
| Nr CAS |
2912-62-1 |
| EINECS |
220-826-7 |
| Struktury molekularnej |
|
| Gęstość |
1.322g/cm3 |
| Temperatura wrzenia |
228°C at 760 mmHg |
| Współczynnik załamania |
1.55 |
| Temperatura zapłonu |
104.4°C |
| Ciśnienie pary |
0.0753mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| Bezpieczeństwo opis |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
