ChemNet > CAS > 2935-63-9 2,3-Dimethylphenoxyacetic acid
2935-63-9 2,3-Dimethylphenoxyacetic acid
Nazwa produktu: |
2,3-Dimethylphenoxyacetic acid |
Angielska nazwa |
2,3-Dimethylphenoxyacetic acid;2,3-Xylyloxyacetic acid; (2,3-dimethylphenoxy)acetate |
MF |
C10H11O3 |
Masie cząsteczkowej |
179.1931 |
InChI |
InChI=1/C10H12O3/c1-7-4-3-5-9(8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
Nr CAS |
2935-63-9 |
EINECS |
220-911-9 |
Struktury molekularnej |
|
Temperatura wrzenia |
315.2°C at 760 mmHg |
Temperatura zapłonu |
124.3°C |
Ciśnienie pary |
0.000187mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|