ChemNet > CAS > 29682-39-1 1-Bromo-2-chloro-4-nitrobenzene
29682-39-1 1-Bromo-2-chloro-4-nitrobenzene
| Nazwa produktu: |
1-Bromo-2-chloro-4-nitrobenzene |
| Angielska nazwa |
1-Bromo-2-chloro-4-nitrobenzene; 4-Bromo-3-chloronitrobenzene |
| MF |
C6H3BrClNO2 |
| Masie cząsteczkowej |
236.4505 |
| InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| Nr CAS |
29682-39-1 |
| EINECS |
249-773-8 |
| Struktury molekularnej |
|
| Gęstość |
1.827g/cm3 |
| Temperatura wrzenia |
282.2°C at 760 mmHg |
| Współczynnik załamania |
1.618 |
| Temperatura zapłonu |
124.5°C |
| Ciśnienie pary |
0.0058mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
