ChemNet > CAS > 29886-62-2 4-(2-thienyl)benzoic acid
29886-62-2 4-(2-thienyl)benzoic acid
Nazwa produktu: |
4-(2-thienyl)benzoic acid |
Angielska nazwa |
4-(2-thienyl)benzoic acid;4-(thiophen-2-yl)benzoic acid; 4-thiophen-2-ylbenzoate |
MF |
C11H7O2S |
Masie cząsteczkowej |
203.2376 |
InChI |
InChI=1/C11H8O2S/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h1-7H,(H,12,13)/p-1 |
Nr CAS |
29886-62-2 |
Struktury molekularnej |
|
Temperatura topnienia |
243℃ |
Temperatura wrzenia |
372.8°C at 760 mmHg |
Temperatura zapłonu |
179.3°C |
Ciśnienie pary |
3.23E-06mmHg at 25°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|