ChemNet > CAS > 30544-34-4 2,3-Dibromofuran
30544-34-4 2,3-Dibromofuran
| Nazwa produktu: |
2,3-Dibromofuran |
| Angielska nazwa |
2,3-Dibromofuran; |
| MF |
C4H2Br2O |
| Masie cząsteczkowej |
225.8661 |
| InChI |
InChI=1/C4H2Br2O/c5-3-1-2-7-4(3)6/h1-2H |
| Nr CAS |
30544-34-4 |
| Struktury molekularnej |
|
| Gęstość |
2.159g/cm3 |
| Temperatura wrzenia |
175.6°C at 760 mmHg |
| Współczynnik załamania |
1.562 |
| Temperatura zapłonu |
60°C |
| Ciśnienie pary |
1.53mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
