ChemNet > CAS > 312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
| Nazwa produktu: |
4-(Trifluoromethylsulfonyl)benzonitrile |
| Angielska nazwa |
4-(Trifluoromethylsulfonyl)benzonitrile; 4-Cyanophenyl trifluoromethyl sulphone; 4-(Trifluoromethylsulphonyl)benzonitrile; 4-(Trifluoromethanesulfonyl)benzonitrile |
| MF |
C6H4FNO |
| Masie cząsteczkowej |
125.1005 |
| InChI |
InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
| Nr CAS |
312-21-0 |
| Struktury molekularnej |
|
| Gęstość |
1.269g/cm3 |
| Temperatura topnienia |
84-88℃ |
| Temperatura wrzenia |
166.5°C at 760 mmHg |
| Współczynnik załamania |
1.543 |
| Temperatura zapłonu |
54.5°C |
| Ciśnienie pary |
1.78mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
