ChemNet > CAS > 32863-31-3 5-(bromomethyl)-2,1,3-benzoxadiazole
32863-31-3 5-(bromomethyl)-2,1,3-benzoxadiazole
| Nazwa produktu: |
5-(bromomethyl)-2,1,3-benzoxadiazole |
| Angielska nazwa |
5-(bromomethyl)-2,1,3-benzoxadiazole; |
| MF |
C7H5BrN2O |
| Masie cząsteczkowej |
213.0314 |
| InChI |
InChI=1/C7H5BrN2O/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| Nr CAS |
32863-31-3 |
| Struktury molekularnej |
|
| Gęstość |
1.742g/cm3 |
| Temperatura wrzenia |
283.5°C at 760 mmHg |
| Współczynnik załamania |
1.661 |
| Temperatura zapłonu |
125.3°C |
| Ciśnienie pary |
0.00538mmHg at 25°C |
| Symbole zagrożenia |
 C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
