ChemNet > CAS > 331-62-4 3-fluoro-4-methoxybenzonitrile
331-62-4 3-fluoro-4-methoxybenzonitrile
Nazwa produktu: |
3-fluoro-4-methoxybenzonitrile |
Angielska nazwa |
3-fluoro-4-methoxybenzonitrile; Fluoromethoxybenzonitrile |
MF |
C8H6FNO |
Masie cząsteczkowej |
151.1377 |
InChI |
InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
Nr CAS |
331-62-4 |
Struktury molekularnej |
|
Gęstość |
1.18g/cm3 |
Temperatura wrzenia |
254.3°C at 760 mmHg |
Współczynnik załamania |
1.505 |
Temperatura zapłonu |
107.6°C |
Ciśnienie pary |
0.0173mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|