ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
Nazwa produktu: |
3,3'-difluorobenzophenone |
Angielska nazwa |
3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
MF |
C13H8F2O |
Masie cząsteczkowej |
218.1988 |
InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
Nr CAS |
345-70-0 |
Struktury molekularnej |
|
Gęstość |
1.239g/cm3 |
Temperatura topnienia |
56-59℃ |
Temperatura wrzenia |
316.2°C at 760 mmHg |
Współczynnik załamania |
1.549 |
Temperatura zapłonu |
121.3°C |
Ciśnienie pary |
0.000415mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|