ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
| Nazwa produktu: |
Pentamethylphenylacetonitrile |
| Angielska nazwa |
Pentamethylphenylacetonitrile; 2,3,4,5,6-Pentamethylbenzyl cyanide |
| MF |
C13H17N |
| Masie cząsteczkowej |
187.2808 |
| InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
| Nr CAS |
34688-70-5 |
| Struktury molekularnej |
|
| Gęstość |
0.95g/cm3 |
| Temperatura topnienia |
105-107℃ |
| Temperatura wrzenia |
325.9°C at 760 mmHg |
| Współczynnik załamania |
1.519 |
| Temperatura zapłonu |
160.2°C |
| Ciśnienie pary |
0.000224mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/22:Harmful by inhalation and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
