34824-58-3 2-Bromophenyldioxolane
Nazwa produktu: |
2-Bromophenyldioxolane |
Angielska nazwa |
2-Bromophenyldioxolane; 2-(2-Bromophenyl)-1,3-dioxolane; 2-Bromobenzaldehyde ethylene acetal |
MF |
C9H9BrO2 |
Masie cząsteczkowej |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c10-8-4-2-1-3-7(8)9-11-5-6-12-9/h1-4,9H,5-6H2 |
Nr CAS |
34824-58-3 |
Struktury molekularnej |
|
Gęstość |
1.515g/cm3 |
Temperatura wrzenia |
272.1°C at 760 mmHg |
Współczynnik załamania |
1.564 |
Temperatura zapłonu |
120.8°C |
Ciśnienie pary |
0.0103mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|