3491-63-2 2-Phenyl-2-pentenal
Nazwa produktu: |
2-Phenyl-2-pentenal |
Angielska nazwa |
2-Phenyl-2-pentenal;Benzeneacetaldehyde, alpha-propylidene-; (2E)-2-phenylpent-2-enal |
MF |
C11H12O |
Masie cząsteczkowej |
160.2124 |
InChI |
InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
Nr CAS |
3491-63-2 |
Struktury molekularnej |
|
Gęstość |
0.976g/cm3 |
Temperatura wrzenia |
286.7°C at 760 mmHg |
Współczynnik załamania |
1.524 |
Temperatura zapłonu |
106.2°C |
Ciśnienie pary |
0.0026mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R36/38:Irritating to eyes and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|