ChemNet > CAS > 3512-17-2 2,4,6-Trifluoropyridine
3512-17-2 2,4,6-Trifluoropyridine
| Nazwa produktu: |
2,4,6-Trifluoropyridine |
| Angielska nazwa |
2,4,6-Trifluoropyridine; |
| MF |
C5H2F3N |
| Masie cząsteczkowej |
133.0713 |
| InChI |
InChI=1/C5H2F3N/c6-3-1-4(7)9-5(8)2-3/h1-2H |
| Nr CAS |
3512-17-2 |
| Struktury molekularnej |
|
| Gęstość |
1.396g/cm3 |
| Temperatura wrzenia |
121.9°C at 760 mmHg |
| Współczynnik załamania |
1.424 |
| Temperatura zapłonu |
27.5°C |
| Ciśnienie pary |
17.2mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R11:Highly flammable.;
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
