ChemNet > CAS > 35884-42-5 di(propylene glycol) butyl ether, mixture of
35884-42-5 di(propylene glycol) butyl ether, mixture of
| Nazwa produktu: |
di(propylene glycol) butyl ether, mixture of |
| Angielska nazwa |
di(propylene glycol) butyl ether, mixture of; Di(propylene glycol) butyl ether,mixture of isomers; 1-(3-butoxypropoxy)propan-1-ol; Dipropylene glycol butyl ether |
| MF |
C10H22O3 |
| Masie cząsteczkowej |
190.2799 |
| InChI |
InChI=1/C10H22O3/c1-3-5-7-12-8-6-9-13-10(11)4-2/h10-11H,3-9H2,1-2H3 |
| Nr CAS |
35884-42-5 |
| EINECS |
252-776-7 |
| Struktury molekularnej |
|
| Gęstość |
0.931g/cm3 |
| Temperatura wrzenia |
221.1°C at 760 mmHg |
| Współczynnik załamania |
1.435 |
| Temperatura zapłonu |
87.5°C |
| Ciśnienie pary |
0.0226mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
|
| Bezpieczeństwo opis |
|
|
