ChemNet > CAS > 37107-50-9 Cyclohexylidenecyanoacetic acid
37107-50-9 Cyclohexylidenecyanoacetic acid
| Nazwa produktu: |
Cyclohexylidenecyanoacetic acid |
| Angielska nazwa |
Cyclohexylidenecyanoacetic acid;Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
| MF |
C9H11NO2 |
| Masie cząsteczkowej |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
| Nr CAS |
37107-50-9 |
| EINECS |
253-351-9 |
| Struktury molekularnej |
|
| Gęstość |
1.211g/cm3 |
| Temperatura wrzenia |
353.9°C at 760 mmHg |
| Współczynnik załamania |
1.537 |
| Temperatura zapłonu |
167.8°C |
| Ciśnienie pary |
5.84E-06mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
