ChemNet > CAS > 374537-97-0 2-Amino-5-bromo-3,4-dimethylpyridine
374537-97-0 2-Amino-5-bromo-3,4-dimethylpyridine
| Nazwa produktu: |
2-Amino-5-bromo-3,4-dimethylpyridine |
| Angielska nazwa |
2-Amino-5-bromo-3,4-dimethylpyridine; 5-Bromo-3,4-dimethyl-2-pyridinamine; 5-bromo-3,4-dimethylpyridin-2-amine |
| MF |
C7H9BrN2 |
| Masie cząsteczkowej |
201.0638 |
| InChI |
InChI=1/C7H9BrN2/c1-4-5(2)7(9)10-3-6(4)8/h3H,1-2H3,(H2,9,10) |
| Nr CAS |
374537-97-0 |
| Struktury molekularnej |
|
| Gęstość |
1.504g/cm3 |
| Temperatura wrzenia |
278.2°C at 760 mmHg |
| Współczynnik załamania |
1.603 |
| Temperatura zapłonu |
122°C |
| Ciśnienie pary |
0.00434mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
