ChemNet > CAS > 39101-54-7 3,5-Dimethylphenylacetonitrile
39101-54-7 3,5-Dimethylphenylacetonitrile
Nazwa produktu: |
3,5-Dimethylphenylacetonitrile |
Angielska nazwa |
3,5-Dimethylphenylacetonitrile; 3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
MF |
C10H11N |
Masie cząsteczkowej |
145.201 |
InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
Nr CAS |
39101-54-7 |
EINECS |
254-292-1 |
Struktury molekularnej |
|
Gęstość |
0.979g/cm3 |
Temperatura wrzenia |
254.5°C at 760 mmHg |
Współczynnik załamania |
1.524 |
Temperatura zapłonu |
117.5°C |
Ciśnienie pary |
0.0172mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|