ChemNet > CAS > 395-81-3 5-fluoro-2-nitrobenzaldehyde
395-81-3 5-fluoro-2-nitrobenzaldehyde
| Nazwa produktu: |
5-fluoro-2-nitrobenzaldehyde |
| Angielska nazwa |
5-fluoro-2-nitrobenzaldehyde; 2-Nitro-5-Fluorobenzaldehyde; 5-Fluoro-2-nitrobenzadehyde |
| MF |
C8H7FO3 |
| Masie cząsteczkowej |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| Nr CAS |
395-81-3 |
| EINECS |
206-903-8 |
| Struktury molekularnej |
|
| Gęstość |
1.307g/cm3 |
| Temperatura topnienia |
92-94℃ |
| Temperatura wrzenia |
266.9°C at 760 mmHg |
| Współczynnik załamania |
1.524 |
| Temperatura zapłonu |
115.2°C |
| Ciśnienie pary |
0.00419mmHg at 25°C |
| Symbole zagrożenia |
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
