ChemNet > CAS > 39769-09-0 4,4'-Difluorobenzylideneaniline
39769-09-0 4,4'-Difluorobenzylideneaniline
| Nazwa produktu: |
4,4'-Difluorobenzylideneaniline |
| Angielska nazwa |
4,4'-Difluorobenzylideneaniline;4-fluoro-N-[(1E)-(4-fluorophenyl)methylidene]aniline |
| MF |
C13H9F2N |
| Masie cząsteczkowej |
217.2141 |
| InChI |
InChI=1/C13H9F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-9H/b16-9+ |
| Nr CAS |
39769-09-0 |
| Struktury molekularnej |
|
| Gęstość |
1.11g/cm3 |
| Temperatura topnienia |
64℃ |
| Temperatura wrzenia |
307.4°C at 760 mmHg |
| Współczynnik załamania |
1.527 |
| Temperatura zapłonu |
139.7°C |
| Ciśnienie pary |
0.00132mmHg at 25°C |
| Symbole zagrożenia |
 Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|
